C19H16BrF2NO5 — CID 27675118
(E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 27675118) has the molecular formula C19H16BrF2NO5 and a molecular weight of 456.24 g/mol. Its IUPAC name is (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 27675118 |
| Molecular Formula | C19H16BrF2NO5 |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | (E)-N-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2cc3c(cc2Br)OCCO3)c1OC(F)F |
| InChI | InChI=1S/C19H16BrF2NO5/c1-25-14-4-2-3-11(18(14)28-19(21)22)5-6-17(24)23-13-10-16-15(9-12(13)20)26-7-8-27-16/h2-6,9-10,19H,7-8H2,1H3,(H,23,24)/b6-5+ |
| InChIKey | WSYLBYVJOJOQEP-AATRIKPKSA-N |
| XLogP | 4.48 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|