C19H19F2NO3 — CID 9191666
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 9191666) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9191666 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2cccc(C)c2C)c1OC(F)F |
| InChI | InChI=1S/C19H19F2NO3/c1-12-6-4-8-15(13(12)2)22-17(23)11-10-14-7-5-9-16(24-3)18(14)25-19(20)21/h4-11,19H,1-3H3,(H,22,23)/b11-10+ |
| InChIKey | VYVRQHCDAFJUQG-ZHACJKMWSA-N |
| XLogP | 4.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|