C16H16F2N2O3S — CID 18198247
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 18198247) has the molecular formula C16H16F2N2O3S and a molecular weight of 354.38 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18198247 |
| Molecular Formula | C16H16F2N2O3S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2nc(C)c(C)s2)c1OC(F)F |
| InChI | InChI=1S/C16H16F2N2O3S/c1-9-10(2)24-16(19-9)20-13(21)8-7-11-5-4-6-12(22-3)14(11)23-15(17)18/h4-8,15H,1-3H3,(H,19,20,21)/b8-7+ |
| InChIKey | UJEOUBOCRRUJRL-BQYQJAHWSA-N |
| XLogP | 4.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|