C18H16ClF2NO3 — CID 7668459
(E)-N-(2-chloro-4-methylphenyl)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 7668459) has the molecular formula C18H16ClF2NO3 and a molecular weight of 367.78 g/mol. Its IUPAC name is (E)-N-(2-chloro-4-methylphenyl)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-chloro-4-methylphenyl)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 7668459 |
| Molecular Formula | C18H16ClF2NO3 |
| Molecular Weight | 367.78 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (E)-N-(2-chloro-4-methylphenyl)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccc(C)cc2Cl)c1OC(F)F |
| InChI | InChI=1S/C18H16ClF2NO3/c1-11-6-8-14(13(19)10-11)22-16(23)9-7-12-4-3-5-15(24-2)17(12)25-18(20)21/h3-10,18H,1-2H3,(H,22,23)/b9-7+ |
| InChIKey | NICXDAHPZDKVSI-VQHVLOKHSA-N |
| XLogP | 4.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|