C21H19F2NO7 — CID 97429008
dimethyl 5-[[(Z)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 97429008) has the molecular formula C21H19F2NO7 and a molecular weight of 435.38 g/mol. Its IUPAC name is dimethyl 5-[[(Z)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(Z)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 97429008 |
| Molecular Formula | C21H19F2NO7 |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | dimethyl 5-[[(Z)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)/C=C\c2cccc(OC)c2OC(F)F)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H19F2NO7/c1-28-16-6-4-5-12(18(16)31-21(22)23)7-8-17(25)24-15-10-13(19(26)29-2)9-14(11-15)20(27)30-3/h4-11,21H,1-3H3,(H,24,25)/b8-7- |
| InChIKey | ZDLCNNXNXUHKKK-FPLPWBNLSA-N |
| XLogP | 3.52 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|