C25H24N2O3 — CID 9321403
N-(2,3-dimethylphenyl)-2-[[(Z)-3-(2-methoxyphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 9321403) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[[(Z)-3-(2-methoxyphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[[(Z)-3-(2-methoxyphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 9321403 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[[(Z)-3-(2-methoxyphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | COc1ccccc1/C=C\C(=O)Nc1ccccc1C(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C25H24N2O3/c1-17-9-8-13-21(18(17)2)27-25(29)20-11-5-6-12-22(20)26-24(28)16-15-19-10-4-7-14-23(19)30-3/h4-16H,1-3H3,(H,26,28)(H,27,29)/b16-15- |
| InChIKey | PFPABOPYGVOBAK-NXVVXOECSA-N |
| XLogP | 5.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|