C25H22N2O5 — CID 108928132
[3-[[2-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108928132) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is [3-[[2-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[2-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928132 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [3-[[2-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | COc1ccccc1/C=C/C(=O)Nc1ccccc1NC(=O)c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C25H22N2O5/c1-17(28)32-20-10-7-9-19(16-20)25(30)27-22-12-5-4-11-21(22)26-24(29)15-14-18-8-3-6-13-23(18)31-2/h3-16H,1-2H3,(H,26,29)(H,27,30)/b15-14+ |
| InChIKey | QPJRCIOTBCGZCP-CCEZHUSRSA-N |
| XLogP | 4.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|