C24H21N3O5 — CID 108928042
[3-[[2-[(3-acetamidobenzoyl)amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108928042) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is [3-[[2-[(3-acetamidobenzoyl)amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[2-[(3-acetamidobenzoyl)amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928042 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [3-[[2-[(3-acetamidobenzoyl)amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Nc1cccc(C(=O)Nc2ccccc2NC(=O)c2cccc(OC(C)=O)c2)c1 |
| InChI | InChI=1S/C24H21N3O5/c1-15(28)25-19-9-5-7-17(13-19)23(30)26-21-11-3-4-12-22(21)27-24(31)18-8-6-10-20(14-18)32-16(2)29/h3-14H,1-2H3,(H,25,28)(H,26,30)(H,27,31) |
| InChIKey | OEDMAOBFBCTXOR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|