C20H15BrN2O5 — CID 108927816
[3-[[3-[(5-bromofuran-2-carbonyl)amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108927816) has the molecular formula C20H15BrN2O5 and a molecular weight of 443.25 g/mol. Its IUPAC name is [3-[[3-[(5-bromofuran-2-carbonyl)amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[(5-bromofuran-2-carbonyl)amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927816 |
| Molecular Formula | C20H15BrN2O5 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | [3-[[3-[(5-bromofuran-2-carbonyl)amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2cccc(NC(=O)c3ccc(Br)o3)c2)c1 |
| InChI | InChI=1S/C20H15BrN2O5/c1-12(24)27-16-7-2-4-13(10-16)19(25)22-14-5-3-6-15(11-14)23-20(26)17-8-9-18(21)28-17/h2-11H,1H3,(H,22,25)(H,23,26) |
| InChIKey | DCGWDMWWJNFWND-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|