C19H15BrN2O3 — CID 1047401
5-bromo-N-[4-[(3-methylbenzoyl)amino]phenyl]furan-2-carboxamide (PubChem CID 1047401) has the molecular formula C19H15BrN2O3 and a molecular weight of 399.24 g/mol. Its IUPAC name is 5-bromo-N-[4-[(3-methylbenzoyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[(3-methylbenzoyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1047401 |
| Molecular Formula | C19H15BrN2O3 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 5-bromo-N-[4-[(3-methylbenzoyl)amino]phenyl]furan-2-carboxamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NC(=O)c3ccc(Br)o3)cc2)c1 |
| InChI | InChI=1S/C19H15BrN2O3/c1-12-3-2-4-13(11-12)18(23)21-14-5-7-15(8-6-14)22-19(24)16-9-10-17(20)25-16/h2-11H,1H3,(H,21,23)(H,22,24) |
| InChIKey | HZPLRGPGTAQQKT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |