C21H17BrN4O4S — CID 4503366
5-bromo-N-[[[4-[(3-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]furan-2-carboxamide (PubChem CID 4503366) has the molecular formula C21H17BrN4O4S and a molecular weight of 501.36 g/mol. Its IUPAC name is 5-bromo-N-[[[4-[(3-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[[[4-[(3-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4503366 |
| Molecular Formula | C21H17BrN4O4S |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.02 |
| IUPAC Name | 5-bromo-N-[[[4-[(3-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)NNC(=S)NC(=O)c3ccc(Br)o3)cc2)c1 |
| InChI | InChI=1S/C21H17BrN4O4S/c1-12-3-2-4-14(11-12)18(27)23-15-7-5-13(6-8-15)19(28)25-26-21(31)24-20(29)16-9-10-17(22)30-16/h2-11H,1H3,(H,23,27)(H,25,28)(H2,24,26,29,31) |
| InChIKey | HDYCQXHDLGFAME-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|