C23H22BrN3O4 — CID 3379575
N-[4-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]phenyl]-4-tert-butylbenzamide (PubChem CID 3379575) has the molecular formula C23H22BrN3O4 and a molecular weight of 484.35 g/mol. Its IUPAC name is N-[4-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[4-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 3379575 |
| Molecular Formula | C23H22BrN3O4 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-[4-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]phenyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)NNC(=O)c3ccc(Br)o3)cc2)cc1 |
| InChI | InChI=1S/C23H22BrN3O4/c1-23(2,3)16-8-4-14(5-9-16)20(28)25-17-10-6-15(7-11-17)21(29)26-27-22(30)18-12-13-19(24)31-18/h4-13H,1-3H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | JGRIMJWYOSNYJU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|