C13H12BrN3O4 — CID 17381934
1-[(5-bromofuran-2-carbonyl)amino]-3-(4-methoxyphenyl)urea (PubChem CID 17381934) has the molecular formula C13H12BrN3O4 and a molecular weight of 354.16 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-carbonyl)amino]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(5-bromofuran-2-carbonyl)amino]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 17381934 |
| Molecular Formula | C13H12BrN3O4 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 1-[(5-bromofuran-2-carbonyl)amino]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NNC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C13H12BrN3O4/c1-20-9-4-2-8(3-5-9)15-13(19)17-16-12(18)10-6-7-11(14)21-10/h2-7H,1H3,(H,16,18)(H2,15,17,19) |
| InChIKey | ITYJPUXITFQHKG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|