C15H13BrN4O4S — CID 4503159
N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-5-bromofuran-2-carboxamide (PubChem CID 4503159) has the molecular formula C15H13BrN4O4S and a molecular weight of 425.26 g/mol. Its IUPAC name is N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 4503159 |
| Molecular Formula | C15H13BrN4O4S |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-5-bromofuran-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C15H13BrN4O4S/c1-8(21)17-10-4-2-9(3-5-10)13(22)19-20-15(25)18-14(23)11-6-7-12(16)24-11/h2-7H,1H3,(H,17,21)(H,19,22)(H2,18,20,23,25) |
| InChIKey | MZASGQAMUBMFAA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|