C17H15N5O5S — CID 5089049
N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-4-nitrobenzamide (PubChem CID 5089049) has the molecular formula C17H15N5O5S and a molecular weight of 401.40 g/mol. Its IUPAC name is N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5089049 |
| Molecular Formula | C17H15N5O5S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-4-nitrobenzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H15N5O5S/c1-10(23)18-13-6-2-12(3-7-13)16(25)20-21-17(28)19-15(24)11-4-8-14(9-5-11)22(26)27/h2-9H,1H3,(H,18,23)(H,20,25)(H2,19,21,24,28) |
| InChIKey | SNYDTUXFXFNAPG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|