C28H27N5O5S — CID 17187393
4-tert-butyl-N-[4-[[[(E)-3-(4-nitrophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]benzamide (PubChem CID 17187393) has the molecular formula C28H27N5O5S and a molecular weight of 545.62 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[[(E)-3-(4-nitrophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[[(E)-3-(4-nitrophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17187393 |
| Molecular Formula | C28H27N5O5S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 4-tert-butyl-N-[4-[[[(E)-3-(4-nitrophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)NNC(=S)NC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C28H27N5O5S/c1-28(2,3)21-11-7-19(8-12-21)25(35)29-22-13-9-20(10-14-22)26(36)31-32-27(39)30-24(34)17-6-18-4-15-23(16-5-18)33(37)38/h4-17H,1-3H3,(H,29,35)(H,31,36)(H2,30,32,34,39)/b17-6+ |
| InChIKey | ASIYCSMEZZCPTI-UBKPWBPPSA-N |
| XLogP | 4.49 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|