C11H11N3O3S — CID 17187248
(E)-N-(methylcarbamothioyl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 17187248) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is (E)-N-(methylcarbamothioyl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(methylcarbamothioyl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17187248 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (E)-N-(methylcarbamothioyl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CNC(=S)NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H11N3O3S/c1-12-11(18)13-10(15)7-4-8-2-5-9(6-3-8)14(16)17/h2-7H,1H3,(H2,12,13,15,18)/b7-4+ |
| InChIKey | KXHITJUCNVTUQJ-QPJJXVBHSA-N |
| XLogP | 1.23 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|