C14H13N5O3S2 — CID 54787437
(E)-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 54787437) has the molecular formula C14H13N5O3S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is (E)-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54787437 |
| Molecular Formula | C14H13N5O3S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (E)-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCc1nnc(NC(=S)NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C14H13N5O3S2/c1-2-12-17-18-14(24-12)16-13(23)15-11(20)8-5-9-3-6-10(7-4-9)19(21)22/h3-8H,2H2,1H3,(H2,15,16,18,20,23)/b8-5+ |
| InChIKey | KSFOSBKKYZHQFI-VMPITWQZSA-N |
| XLogP | 2.54 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|