C20H13N5O5S — CID 108732758
(E)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 108732758) has the molecular formula C20H13N5O5S and a molecular weight of 435.42 g/mol. Its IUPAC name is (E)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108732758 |
| Molecular Formula | C20H13N5O5S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | (E)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)Nc1nnc(CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C20H13N5O5S/c26-16(10-7-12-5-8-13(9-6-12)25(29)30)21-20-23-22-17(31-20)11-24-18(27)14-3-1-2-4-15(14)19(24)28/h1-10H,11H2,(H,21,23,26)/b10-7+ |
| InChIKey | HSOJRRMRYWCXFT-JXMROGBWSA-N |
| XLogP | 2.89 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|