C11H9N5O2S — CID 80613793
2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]isoindole-1,3-dione (PubChem CID 80613793) has the molecular formula C11H9N5O2S and a molecular weight of 275.29 g/mol. Its IUPAC name is 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 80613793 |
| Molecular Formula | C11H9N5O2S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]isoindole-1,3-dione |
| SMILES | NNc1nnc(CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C11H9N5O2S/c12-13-11-15-14-8(19-11)5-16-9(17)6-3-1-2-4-7(6)10(16)18/h1-4H,5,12H2,(H,13,15) |
| InChIKey | SXGHVBMEUCOZPT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|