C24H19N5O5S — CID 108756238
2-(1,3-dioxoisoindol-2-yl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-3-methylbutanamide (PubChem CID 108756238) has the molecular formula C24H19N5O5S and a molecular weight of 489.51 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-3-methylbutanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 108756238 |
| Molecular Formula | C24H19N5O5S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)Nc1nnc(CN2C(=O)c3ccccc3C2=O)s1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H19N5O5S/c1-12(2)18(29-22(33)15-9-5-6-10-16(15)23(29)34)19(30)25-24-27-26-17(35-24)11-28-20(31)13-7-3-4-8-14(13)21(28)32/h3-10,12,18H,11H2,1-2H3,(H,25,27,30) |
| InChIKey | XQIPJFNAOIQACU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|