C18H20N4O3S2 — CID 8927056
(2S,3S)-2-(1,3-dioxoisoindol-2-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-methylpentanamide (PubChem CID 8927056) has the molecular formula C18H20N4O3S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-methylpentanamide.
| Compound Name | (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 8927056 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-methylpentanamide |
| SMILES | CCSc1nnc(NC(=O)[C@H]([C@@H](C)CC)N2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C18H20N4O3S2/c1-4-10(3)13(14(23)19-17-20-21-18(27-17)26-5-2)22-15(24)11-8-6-7-9-12(11)16(22)25/h6-10,13H,4-5H2,1-3H3,(H,19,20,23)/t10-,13-/m0/s1 |
| InChIKey | ODSQBWLWDPNDSY-GWCFXTLKSA-N |
| XLogP | 3.30 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|