C18H24N4O3S2 — CID 2479272
benzyl N-[(2S,3R)-1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 2479272) has the molecular formula C18H24N4O3S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3R)-1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 2479272 |
| Molecular Formula | C18H24N4O3S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | benzyl N-[(2S,3R)-1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCSc1nnc(NC(=O)[C@@H](NC(=O)OCc2ccccc2)[C@H](C)CC)s1 |
| InChI | InChI=1S/C18H24N4O3S2/c1-4-12(3)14(15(23)20-16-21-22-18(27-16)26-5-2)19-17(24)25-11-13-9-7-6-8-10-13/h6-10,12,14H,4-5,11H2,1-3H3,(H,19,24)(H,20,21,23)/t12-,14+/m1/s1 |
| InChIKey | GMWASKLOBYMNMX-OCCSQVGLSA-N |
| XLogP | 3.93 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|