C17H22N4O2S2 — CID 8927054
N-[(2S,3S)-1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 8927054) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[(2S,3S)-1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S,3S)-1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 8927054 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(2S,3S)-1-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CCSc1nnc(NC(=O)[C@@H](NC(=O)c2ccccc2)[C@@H](C)CC)s1 |
| InChI | InChI=1S/C17H22N4O2S2/c1-4-11(3)13(18-14(22)12-9-7-6-8-10-12)15(23)19-16-20-21-17(25-16)24-5-2/h6-11,13H,4-5H2,1-3H3,(H,18,22)(H,19,20,23)/t11-,13-/m0/s1 |
| InChIKey | UTDJYRDDQIVMNK-AAEUAGOBSA-N |
| XLogP | 3.43 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|