C16H19N3O2S — CID 41113076
N-[(2R,3R)-3-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]benzamide (PubChem CID 41113076) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[(2R,3R)-3-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]benzamide.
| Compound Name | N-[(2R,3R)-3-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 41113076 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[(2R,3R)-3-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]benzamide |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)c1ccccc1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C16H19N3O2S/c1-3-11(2)13(15(21)19-16-17-9-10-22-16)18-14(20)12-7-5-4-6-8-12/h4-11,13H,3H2,1-2H3,(H,18,20)(H,17,19,21)/t11-,13-/m1/s1 |
| InChIKey | KLQWWCPERIVXIS-DGCLKSJQSA-N |
| XLogP | 2.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |