C19H22N4O3 — CID 9033179
N-[(2S,3S)-3-methyl-1-oxo-1-[2-(pyridine-2-carbonyl)hydrazinyl]pentan-2-yl]benzamide (PubChem CID 9033179) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[(2S,3S)-3-methyl-1-oxo-1-[2-(pyridine-2-carbonyl)hydrazinyl]pentan-2-yl]benzamide.
| Compound Name | N-[(2S,3S)-3-methyl-1-oxo-1-[2-(pyridine-2-carbonyl)hydrazinyl]pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 9033179 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[(2S,3S)-3-methyl-1-oxo-1-[2-(pyridine-2-carbonyl)hydrazinyl]pentan-2-yl]benzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccccc1)C(=O)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C19H22N4O3/c1-3-13(2)16(21-17(24)14-9-5-4-6-10-14)19(26)23-22-18(25)15-11-7-8-12-20-15/h4-13,16H,3H2,1-2H3,(H,21,24)(H,22,25)(H,23,26)/t13-,16-/m0/s1 |
| InChIKey | HVOCGEXRCWGIER-BBRMVZONSA-N |
| XLogP | 1.69 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|