C27H28N4O4 — CID 3455596
2-benzamido-N-[1-(2-benzoylhydrazinyl)-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 3455596) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-benzamido-N-[1-(2-benzoylhydrazinyl)-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-benzamido-N-[1-(2-benzoylhydrazinyl)-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 3455596 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-benzamido-N-[1-(2-benzoylhydrazinyl)-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CCC(C)C(NC(=O)c1ccccc1NC(=O)c1ccccc1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28N4O4/c1-3-18(2)23(27(35)31-30-25(33)20-14-8-5-9-15-20)29-26(34)21-16-10-11-17-22(21)28-24(32)19-12-6-4-7-13-19/h4-18,23H,3H2,1-2H3,(H,28,32)(H,29,34)(H,30,33)(H,31,35) |
| InChIKey | LOABJOHZCNHVQJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|