C21H23N2O5- — CID 7392970
(2R,3S)-2-[[2-[(4-methoxybenzoyl)amino]benzoyl]amino]-3-methylpentanoate (PubChem CID 7392970) has the molecular formula C21H23N2O5- and a molecular weight of 383.42 g/mol. Its IUPAC name is (2R,3S)-2-[[2-[(4-methoxybenzoyl)amino]benzoyl]amino]-3-methylpentanoate.
| Compound Name | (2R,3S)-2-[[2-[(4-methoxybenzoyl)amino]benzoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 7392970 |
| Molecular Formula | C21H23N2O5- |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (2R,3S)-2-[[2-[(4-methoxybenzoyl)amino]benzoyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](NC(=O)c1ccccc1NC(=O)c1ccc(OC)cc1)C(=O)[O-] |
| InChI | InChI=1S/C21H24N2O5/c1-4-13(2)18(21(26)27)23-20(25)16-7-5-6-8-17(16)22-19(24)14-9-11-15(28-3)12-10-14/h5-13,18H,4H2,1-3H3,(H,22,24)(H,23,25)(H,26,27)/p-1/t13-,18+/m0/s1 |
| InChIKey | GZVYHDKHVKVGQQ-SCLBCKFNSA-M |
| XLogP | 1.84 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |