C25H33N3O4 — CID 29064290
N-[(2R,3S)-1-(butylamino)-3-methyl-1-oxopentan-2-yl]-2-[(4-methoxybenzoyl)amino]benzamide (PubChem CID 29064290) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[(2R,3S)-1-(butylamino)-3-methyl-1-oxopentan-2-yl]-2-[(4-methoxybenzoyl)amino]benzamide.
| Compound Name | N-[(2R,3S)-1-(butylamino)-3-methyl-1-oxopentan-2-yl]-2-[(4-methoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 29064290 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-[(2R,3S)-1-(butylamino)-3-methyl-1-oxopentan-2-yl]-2-[(4-methoxybenzoyl)amino]benzamide |
| SMILES | CCCCNC(=O)[C@H](NC(=O)c1ccccc1NC(=O)c1ccc(OC)cc1)[C@@H](C)CC |
| InChI | InChI=1S/C25H33N3O4/c1-5-7-16-26-25(31)22(17(3)6-2)28-24(30)20-10-8-9-11-21(20)27-23(29)18-12-14-19(32-4)15-13-18/h8-15,17,22H,5-7,16H2,1-4H3,(H,26,31)(H,27,29)(H,28,30)/t17-,22+/m0/s1 |
| InChIKey | GSACPZIOXUCKEN-HTAPYJJXSA-N |
| XLogP | 4.01 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|