C28H30N4O6 — CID 3123973
2-[(4-methoxybenzoyl)amino]-N-[1-[2-(4-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3123973) has the molecular formula C28H30N4O6 and a molecular weight of 518.57 g/mol. Its IUPAC name is 2-[(4-methoxybenzoyl)amino]-N-[1-[2-(4-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-[(4-methoxybenzoyl)amino]-N-[1-[2-(4-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3123973 |
| Molecular Formula | C28H30N4O6 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-[(4-methoxybenzoyl)amino]-N-[1-[2-(4-methoxybenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)NNC(=O)C(NC(=O)c2ccccc2NC(=O)c2ccc(OC)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C28H30N4O6/c1-17(2)24(28(36)32-31-26(34)19-11-15-21(38-4)16-12-19)30-27(35)22-7-5-6-8-23(22)29-25(33)18-9-13-20(37-3)14-10-18/h5-17,24H,1-4H3,(H,29,33)(H,30,35)(H,31,34)(H,32,36) |
| InChIKey | CECWGMHKTCMQSE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|