C27H33N5O4 — CID 40830903
N-[(2S,3R)-1-(3-imidazol-1-ylpropylamino)-3-methyl-1-oxopentan-2-yl]-2-[(4-methoxybenzoyl)amino]benzamide (PubChem CID 40830903) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3-imidazol-1-ylpropylamino)-3-methyl-1-oxopentan-2-yl]-2-[(4-methoxybenzoyl)amino]benzamide.
| Compound Name | N-[(2S,3R)-1-(3-imidazol-1-ylpropylamino)-3-methyl-1-oxopentan-2-yl]-2-[(4-methoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 40830903 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-[(2S,3R)-1-(3-imidazol-1-ylpropylamino)-3-methyl-1-oxopentan-2-yl]-2-[(4-methoxybenzoyl)amino]benzamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)c1ccccc1NC(=O)c1ccc(OC)cc1)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C27H33N5O4/c1-4-19(2)24(27(35)29-14-7-16-32-17-15-28-18-32)31-26(34)22-8-5-6-9-23(22)30-25(33)20-10-12-21(36-3)13-11-20/h5-6,8-13,15,17-19,24H,4,7,14,16H2,1-3H3,(H,29,35)(H,30,33)(H,31,34)/t19-,24+/m1/s1 |
| InChIKey | NMXUQHOCEWMMMB-DVECYGJZSA-N |
| XLogP | 3.49 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|