C28H35N5O4 — CID 25357511
N-[(3S,4S)-1-(3-imidazol-1-ylpropylamino)-4-methyl-2-oxohexan-3-yl]-2-[(4-methoxybenzoyl)amino]benzamide (PubChem CID 25357511) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-[(3S,4S)-1-(3-imidazol-1-ylpropylamino)-4-methyl-2-oxohexan-3-yl]-2-[(4-methoxybenzoyl)amino]benzamide.
| Compound Name | N-[(3S,4S)-1-(3-imidazol-1-ylpropylamino)-4-methyl-2-oxohexan-3-yl]-2-[(4-methoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 25357511 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | N-[(3S,4S)-1-(3-imidazol-1-ylpropylamino)-4-methyl-2-oxohexan-3-yl]-2-[(4-methoxybenzoyl)amino]benzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccccc1NC(=O)c1ccc(OC)cc1)C(=O)CNCCCn1ccnc1 |
| InChI | InChI=1S/C28H35N5O4/c1-4-20(2)26(25(34)18-29-14-7-16-33-17-15-30-19-33)32-28(36)23-8-5-6-9-24(23)31-27(35)21-10-12-22(37-3)13-11-21/h5-6,8-13,15,17,19-20,26,29H,4,7,14,16,18H2,1-3H3,(H,31,35)(H,32,36)/t20-,26-/m0/s1 |
| InChIKey | XPIBPADBURGDKU-FNZWTVRRSA-N |
| XLogP | 3.54 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|