C32H32N4O3 — CID 29057414
2-benzamido-N-[(2R,3S)-1-(2,2-diphenylhydrazinyl)-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 29057414) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is 2-benzamido-N-[(2R,3S)-1-(2,2-diphenylhydrazinyl)-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-benzamido-N-[(2R,3S)-1-(2,2-diphenylhydrazinyl)-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 29057414 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 2-benzamido-N-[(2R,3S)-1-(2,2-diphenylhydrazinyl)-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@H](C)[C@@H](NC(=O)c1ccccc1NC(=O)c1ccccc1)C(=O)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32N4O3/c1-3-23(2)29(32(39)35-36(25-17-9-5-10-18-25)26-19-11-6-12-20-26)34-31(38)27-21-13-14-22-28(27)33-30(37)24-15-7-4-8-16-24/h4-23,29H,3H2,1-2H3,(H,33,37)(H,34,38)(H,35,39)/t23-,29+/m0/s1 |
| InChIKey | CSQNVSHYQLGMOS-MUAVYFROSA-N |
| XLogP | 5.95 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|