C28H29N3O5 — CID 41190715
ethyl 4-[[(2R)-2-[(2-benzamidobenzoyl)amino]-3-methylbutanoyl]amino]benzoate (PubChem CID 41190715) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is ethyl 4-[[(2R)-2-[(2-benzamidobenzoyl)amino]-3-methylbutanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(2R)-2-[(2-benzamidobenzoyl)amino]-3-methylbutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 41190715 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | ethyl 4-[[(2R)-2-[(2-benzamidobenzoyl)amino]-3-methylbutanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](NC(=O)c2ccccc2NC(=O)c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C28H29N3O5/c1-4-36-28(35)20-14-16-21(17-15-20)29-27(34)24(18(2)3)31-26(33)22-12-8-9-13-23(22)30-25(32)19-10-6-5-7-11-19/h5-18,24H,4H2,1-3H3,(H,29,34)(H,30,32)(H,31,33)/t24-/m1/s1 |
| InChIKey | XPWTZHQJBXJWHK-XMMPIXPASA-N |
| XLogP | 4.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |