C23H20N2O4 — CID 46859858
ethyl 4-[(2-benzoylphenyl)carbamoylamino]benzoate (PubChem CID 46859858) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 4-[(2-benzoylphenyl)carbamoylamino]benzoate.
| Compound Name | ethyl 4-[(2-benzoylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 46859858 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | ethyl 4-[(2-benzoylphenyl)carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O4/c1-2-29-22(27)17-12-14-18(15-13-17)24-23(28)25-20-11-7-6-10-19(20)21(26)16-8-4-3-5-9-16/h3-15H,2H2,1H3,(H2,24,25,28) |
| InChIKey | GTLROYUQKSDSMG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |