C17H16N2O5 — CID 69242497
4-[(4-ethoxycarbonylphenyl)carbamoylamino]benzoic acid (PubChem CID 69242497) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is 4-[(4-ethoxycarbonylphenyl)carbamoylamino]benzoic acid.
| Compound Name | 4-[(4-ethoxycarbonylphenyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 69242497 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[(4-ethoxycarbonylphenyl)carbamoylamino]benzoic acid |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H16N2O5/c1-2-24-16(22)12-5-9-14(10-6-12)19-17(23)18-13-7-3-11(4-8-13)15(20)21/h3-10H,2H2,1H3,(H,20,21)(H2,18,19,23) |
| InChIKey | ORECACSYZUMMEN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |