C18H16F4N2O4 — CID 11632715
ethyl 4-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoylamino]benzoate (PubChem CID 11632715) has the molecular formula C18H16F4N2O4 and a molecular weight of 400.33 g/mol. Its IUPAC name is ethyl 4-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 11632715 |
| Molecular Formula | C18H16F4N2O4 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | ethyl 4-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2ccc(OC(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H16F4N2O4/c1-2-27-15(25)11-3-5-12(6-4-11)23-17(26)24-13-7-9-14(10-8-13)28-18(21,22)16(19)20/h3-10,16H,2H2,1H3,(H2,23,24,26) |
| InChIKey | HBBKGFIWFLKKLU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|