C12H12F4O3 — CID 88799052
ethyl 2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]acetate (PubChem CID 88799052) has the molecular formula C12H12F4O3 and a molecular weight of 280.22 g/mol. Its IUPAC name is ethyl 2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 88799052 |
| Molecular Formula | C12H12F4O3 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | ethyl 2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H12F4O3/c1-2-18-10(17)7-8-3-5-9(6-4-8)19-12(15,16)11(13)14/h3-6,11H,2,7H2,1H3 |
| InChIKey | XRAZMWZZGLRWNJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|