C10H10F4N2O2 — CID 156545746
N'-hydroxy-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanimidamide (PubChem CID 156545746) has the molecular formula C10H10F4N2O2 and a molecular weight of 266.19 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 156545746 |
| Molecular Formula | C10H10F4N2O2 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N'-hydroxy-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanimidamide |
| SMILES | N/C(Cc1ccc(OC(F)(F)C(F)F)cc1)=N\O |
| InChI | InChI=1S/C10H10F4N2O2/c11-9(12)10(13,14)18-7-3-1-6(2-4-7)5-8(15)16-17/h1-4,9,17H,5H2,(H2,15,16) |
| InChIKey | SQFUMECOIKVGDL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|