C10H11F4NO2 — CID 66515285
(2R)-2-amino-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol (PubChem CID 66515285) has the molecular formula C10H11F4NO2 and a molecular weight of 253.20 g/mol. Its IUPAC name is (2R)-2-amino-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol.
| Compound Name | (2R)-2-amino-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 66515285 |
| Molecular Formula | C10H11F4NO2 |
| Molecular Weight | 253.20 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (2R)-2-amino-2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol |
| SMILES | N[C@@H](CO)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H11F4NO2/c11-9(12)10(13,14)17-7-3-1-6(2-4-7)8(15)5-16/h1-4,8-9,16H,5,15H2/t8-/m0/s1 |
| InChIKey | NBCNJLQKUHPMQL-QMMMGPOBSA-N |
| XLogP | 1.92 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|