C12H15F4NO — CID 171228244
(1S)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-amine (PubChem CID 171228244) has the molecular formula C12H15F4NO and a molecular weight of 265.25 g/mol. Its IUPAC name is (1S)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-amine.
| Compound Name | (1S)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 171228244 |
| Molecular Formula | C12H15F4NO |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (1S)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-amine |
| SMILES | CCC[C@H](N)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H15F4NO/c1-2-3-10(17)8-4-6-9(7-5-8)18-12(15,16)11(13)14/h4-7,10-11H,2-3,17H2,1H3/t10-/m0/s1 |
| InChIKey | KSPIWMFDNFLZSL-JTQLQIEISA-N |
| XLogP | 3.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|