C11H13ClF5NO — CID 171228261
(1S)-3-fluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride (PubChem CID 171228261) has the molecular formula C11H13ClF5NO and a molecular weight of 305.67 g/mol. Its IUPAC name is (1S)-3-fluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride.
| Compound Name | (1S)-3-fluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171228261 |
| Molecular Formula | C11H13ClF5NO |
| Molecular Weight | 305.67 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (1S)-3-fluoro-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CCF)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H12F5NO.ClH/c12-6-5-9(17)7-1-3-8(4-2-7)18-11(15,16)10(13)14;/h1-4,9-10H,5-6,17H2;1H/t9-;/m0./s1 |
| InChIKey | RESOJMNJQVWYAD-FVGYRXGTSA-N |
| XLogP | 3.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|