C12H17ClF4N2O — CID 171228235
(1S)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butane-1,4-diamine;hydrochloride (PubChem CID 171228235) has the molecular formula C12H17ClF4N2O and a molecular weight of 316.73 g/mol. Its IUPAC name is (1S)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171228235 |
| Molecular Formula | C12H17ClF4N2O |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (1S)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@H](N)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H16F4N2O.ClH/c13-11(14)12(15,16)19-9-5-3-8(4-6-9)10(18)2-1-7-17;/h3-6,10-11H,1-2,7,17-18H2;1H/t10-;/m0./s1 |
| InChIKey | HKLDCLORDURSGR-PPHPATTJSA-N |
| XLogP | 3.08 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|