C12H19ClF2N2O — CID 171206168
(1R)-1-[4-(difluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride (PubChem CID 171206168) has the molecular formula C12H19ClF2N2O and a molecular weight of 280.75 g/mol. Its IUPAC name is (1R)-1-[4-(difluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-[4-(difluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171206168 |
| Molecular Formula | C12H19ClF2N2O |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (1R)-1-[4-(difluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C12H18F2N2O.ClH/c13-12(14)17-10-6-4-9(5-7-10)11(16)3-1-2-8-15;/h4-7,11-12H,1-3,8,15-16H2;1H/t11-;/m1./s1 |
| InChIKey | GDPPUWFQHZCGKU-RFVHGSKJSA-N |
| XLogP | 2.84 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|