C13H20F2N2O — CID 60895427
N'-[1-[4-(difluoromethoxy)phenyl]ethyl]butane-1,4-diamine (PubChem CID 60895427) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is N'-[1-[4-(difluoromethoxy)phenyl]ethyl]butane-1,4-diamine.
| Compound Name | N'-[1-[4-(difluoromethoxy)phenyl]ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 60895427 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N'-[1-[4-(difluoromethoxy)phenyl]ethyl]butane-1,4-diamine |
| SMILES | CC(NCCCCN)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H20F2N2O/c1-10(17-9-3-2-8-16)11-4-6-12(7-5-11)18-13(14)15/h4-7,10,13,17H,2-3,8-9,16H2,1H3 |
| InChIKey | DNNRNEPKOWXXBK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|