C12H14F5NOS — CID 103778139
1-[4-(difluoromethoxy)phenyl]-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine (PubChem CID 103778139) has the molecular formula C12H14F5NOS and a molecular weight of 315.31 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 103778139 |
| Molecular Formula | C12H14F5NOS |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-N-[2-(trifluoromethylsulfanyl)ethyl]ethanamine |
| SMILES | CC(NCCSC(F)(F)F)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C12H14F5NOS/c1-8(18-6-7-20-12(15,16)17)9-2-4-10(5-3-9)19-11(13)14/h2-5,8,11,18H,6-7H2,1H3 |
| InChIKey | JTEDAAAZWDANPS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|