C13H15F2N3O — CID 62998835
1-[4-(difluoromethoxy)phenyl]-N-(1H-imidazol-5-ylmethyl)ethanamine (PubChem CID 62998835) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-N-(1H-imidazol-5-ylmethyl)ethanamine.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-N-(1H-imidazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62998835 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-N-(1H-imidazol-5-ylmethyl)ethanamine |
| SMILES | CC(NCc1cnc[nH]1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H15F2N3O/c1-9(17-7-11-6-16-8-18-11)10-2-4-12(5-3-10)19-13(14)15/h2-6,8-9,13,17H,7H2,1H3,(H,16,18) |
| InChIKey | JTFWEOWWHIYMRV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |