C14H19N3O2 — CID 55109973
1-(3,4-dimethoxyphenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine (PubChem CID 55109973) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 55109973 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-(1H-imidazol-5-ylmethyl)ethanamine |
| SMILES | COc1ccc(C(C)NCc2cnc[nH]2)cc1OC |
| InChI | InChI=1S/C14H19N3O2/c1-10(16-8-12-7-15-9-17-12)11-4-5-13(18-2)14(6-11)19-3/h4-7,9-10,16H,8H2,1-3H3,(H,15,17) |
| InChIKey | ZCSWAZYBJRPQMN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |