C13H22N2O2 — CID 60890070
N'-[1-(3,4-dimethoxyphenyl)ethyl]propane-1,3-diamine (PubChem CID 60890070) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N'-[1-(3,4-dimethoxyphenyl)ethyl]propane-1,3-diamine.
| Compound Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60890070 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]propane-1,3-diamine |
| SMILES | COc1ccc(C(C)NCCCN)cc1OC |
| InChI | InChI=1S/C13H22N2O2/c1-10(15-8-4-7-14)11-5-6-12(16-2)13(9-11)17-3/h5-6,9-10,15H,4,7-8,14H2,1-3H3 |
| InChIKey | RPBYPEXYALHAOO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|