C15H24N2O3 — CID 103529821
5-[1-(3,4-dimethoxyphenyl)ethylamino]pentanamide (PubChem CID 103529821) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-[1-(3,4-dimethoxyphenyl)ethylamino]pentanamide.
| Compound Name | 5-[1-(3,4-dimethoxyphenyl)ethylamino]pentanamide |
|---|---|
| PubChem CID | 103529821 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5-[1-(3,4-dimethoxyphenyl)ethylamino]pentanamide |
| SMILES | COc1ccc(C(C)NCCCCC(N)=O)cc1OC |
| InChI | InChI=1S/C15H24N2O3/c1-11(17-9-5-4-6-15(16)18)12-7-8-13(19-2)14(10-12)20-3/h7-8,10-11,17H,4-6,9H2,1-3H3,(H2,16,18) |
| InChIKey | WJFQEBNISRCJFZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|